3-methyl-N-{2-oxo-1-[1-(3-phenylpropanoyl)piperidin-4-yl]-2-[(prop-2-en-1-yl)amino]ethyl}benzamide
Chemical Structure Depiction of
3-methyl-N-{2-oxo-1-[1-(3-phenylpropanoyl)piperidin-4-yl]-2-[(prop-2-en-1-yl)amino]ethyl}benzamide
3-methyl-N-{2-oxo-1-[1-(3-phenylpropanoyl)piperidin-4-yl]-2-[(prop-2-en-1-yl)amino]ethyl}benzamide
Compound characteristics
| Compound ID: | V014-5953 |
| Compound Name: | 3-methyl-N-{2-oxo-1-[1-(3-phenylpropanoyl)piperidin-4-yl]-2-[(prop-2-en-1-yl)amino]ethyl}benzamide |
| Molecular Weight: | 447.58 |
| Molecular Formula: | C27 H33 N3 O3 |
| Smiles: | Cc1cccc(c1)C(NC(C1CCN(CC1)C(CCc1ccccc1)=O)C(NCC=C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4028 |
| logD: | 3.4027 |
| logSw: | -3.7361 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.651 |
| InChI Key: | IUYHRILZNBRRGO-VWLOTQADSA-N |