N-{2-[(3-methoxypropyl)amino]-1-[1-(4-methylbenzene-1-sulfonyl)piperidin-4-yl]-2-oxoethyl}-3-methylbenzamide
Chemical Structure Depiction of
N-{2-[(3-methoxypropyl)amino]-1-[1-(4-methylbenzene-1-sulfonyl)piperidin-4-yl]-2-oxoethyl}-3-methylbenzamide
N-{2-[(3-methoxypropyl)amino]-1-[1-(4-methylbenzene-1-sulfonyl)piperidin-4-yl]-2-oxoethyl}-3-methylbenzamide
Compound characteristics
| Compound ID: | V014-7587 |
| Compound Name: | N-{2-[(3-methoxypropyl)amino]-1-[1-(4-methylbenzene-1-sulfonyl)piperidin-4-yl]-2-oxoethyl}-3-methylbenzamide |
| Molecular Weight: | 501.64 |
| Molecular Formula: | C26 H35 N3 O5 S |
| Smiles: | Cc1ccc(cc1)S(N1CCC(CC1)C(C(NCCCOC)=O)NC(c1cccc(C)c1)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3445 |
| logD: | 3.3444 |
| logSw: | -3.7113 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 88.584 |
| InChI Key: | GKDLNVVELCIIKM-DEOSSOPVSA-N |