N-[8-chloro-11-(morpholin-4-yl)dibenzo[b,f][1,4]oxazepin-2-yl]-2-phenoxyacetamide
Chemical Structure Depiction of
N-[8-chloro-11-(morpholin-4-yl)dibenzo[b,f][1,4]oxazepin-2-yl]-2-phenoxyacetamide
N-[8-chloro-11-(morpholin-4-yl)dibenzo[b,f][1,4]oxazepin-2-yl]-2-phenoxyacetamide
Compound characteristics
| Compound ID: | V014-8049 |
| Compound Name: | N-[8-chloro-11-(morpholin-4-yl)dibenzo[b,f][1,4]oxazepin-2-yl]-2-phenoxyacetamide |
| Molecular Weight: | 463.92 |
| Molecular Formula: | C25 H22 Cl N3 O4 |
| Smiles: | C1COCCN1C1c2cc(ccc2Oc2ccc(cc2N=1)[Cl])NC(COc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3854 |
| logD: | 4.3191 |
| logSw: | -4.6847 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.547 |
| InChI Key: | ZIARGJBGKMJLHJ-UHFFFAOYSA-N |