N~2~-[(3,4-dichlorophenyl)carbamoyl]-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]isoleucinamide
Chemical Structure Depiction of
N~2~-[(3,4-dichlorophenyl)carbamoyl]-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]isoleucinamide
N~2~-[(3,4-dichlorophenyl)carbamoyl]-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]isoleucinamide
Compound characteristics
| Compound ID: | V014-9747 |
| Compound Name: | N~2~-[(3,4-dichlorophenyl)carbamoyl]-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]isoleucinamide |
| Molecular Weight: | 508.43 |
| Molecular Formula: | C22 H23 Cl2 N5 O3 S |
| Salt: | not_available |
| Smiles: | CCC(C)C(C(Nc1nnc(c2ccc(cc2)OC)s1)=O)NC(Nc1ccc(c(c1)[Cl])[Cl])=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.4291 |
| logD: | 6.4288 |
| logSw: | -6.3936 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 87.396 |
| InChI Key: | HYDZGLKCXJDMTH-UHFFFAOYSA-N |