5-(3-chlorophenyl)-N-(cycloheptylmethyl)thiophene-2-carboxamide
Chemical Structure Depiction of
5-(3-chlorophenyl)-N-(cycloheptylmethyl)thiophene-2-carboxamide
5-(3-chlorophenyl)-N-(cycloheptylmethyl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | V014-9975 |
| Compound Name: | 5-(3-chlorophenyl)-N-(cycloheptylmethyl)thiophene-2-carboxamide |
| Molecular Weight: | 347.91 |
| Molecular Formula: | C19 H22 Cl N O S |
| Smiles: | C1CCCC(CC1)CNC(c1ccc(c2cccc(c2)[Cl])s1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.4663 |
| logD: | 6.4663 |
| logSw: | -6.5329 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.9217 |
| InChI Key: | GSUMAKKMXVNEDB-UHFFFAOYSA-N |