ethyl 4-{[(3-methylthiophen-2-yl)methyl]amino}-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 4-{[(3-methylthiophen-2-yl)methyl]amino}-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylate
ethyl 4-{[(3-methylthiophen-2-yl)methyl]amino}-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | V015-2188 |
| Compound Name: | ethyl 4-{[(3-methylthiophen-2-yl)methyl]amino}-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylate |
| Molecular Weight: | 421.44 |
| Molecular Formula: | C20 H18 F3 N3 O2 S |
| Salt: | not_available |
| Smiles: | CCOC(c1cnc(c2ccc(cc2)C(F)(F)F)nc1NCc1c(C)ccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8171 |
| logD: | 5.8171 |
| logSw: | -5.4084 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.706 |
| InChI Key: | NLHRFUGTOZUJFA-UHFFFAOYSA-N |