N-({3-ethyl-1-(4-fluorophenyl)-5-[4-(propan-2-yl)piperazin-1-yl]-1H-pyrazol-4-yl}methyl)-N-propylbutanamide
Chemical Structure Depiction of
N-({3-ethyl-1-(4-fluorophenyl)-5-[4-(propan-2-yl)piperazin-1-yl]-1H-pyrazol-4-yl}methyl)-N-propylbutanamide
N-({3-ethyl-1-(4-fluorophenyl)-5-[4-(propan-2-yl)piperazin-1-yl]-1H-pyrazol-4-yl}methyl)-N-propylbutanamide
Compound characteristics
| Compound ID: | V015-3921 |
| Compound Name: | N-({3-ethyl-1-(4-fluorophenyl)-5-[4-(propan-2-yl)piperazin-1-yl]-1H-pyrazol-4-yl}methyl)-N-propylbutanamide |
| Molecular Weight: | 457.63 |
| Molecular Formula: | C26 H40 F N5 O |
| Salt: | not_available |
| Smiles: | CCCC(N(CCC)Cc1c(CC)nn(c2ccc(cc2)F)c1N1CCN(CC1)C(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2587 |
| logD: | 2.8297 |
| logSw: | -5.0702 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.401 |
| InChI Key: | UIHWRNNERYLCIY-UHFFFAOYSA-N |