2-(3-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)carbamoyl}phenyl)-N-(4-phenylbutyl)pyrimidine-5-carboxamide
Chemical Structure Depiction of
2-(3-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)carbamoyl}phenyl)-N-(4-phenylbutyl)pyrimidine-5-carboxamide
2-(3-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)carbamoyl}phenyl)-N-(4-phenylbutyl)pyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | V015-4070 |
| Compound Name: | 2-(3-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)carbamoyl}phenyl)-N-(4-phenylbutyl)pyrimidine-5-carboxamide |
| Molecular Weight: | 552.67 |
| Molecular Formula: | C33 H36 N4 O4 |
| Salt: | not_available |
| Smiles: | CN(CCc1ccc(c(c1)OC)OC)C(c1cccc(c1)c1ncc(cn1)C(NCCCCc1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2862 |
| logD: | 4.2862 |
| logSw: | -4.2448 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.226 |
| InChI Key: | YPBPUYPTJPQFKV-UHFFFAOYSA-N |