ethyl 1-({2-[(2-fluorophenyl)methyl]-1H-benzimidazol-1-yl}acetyl)piperidine-4-carboxylate
Chemical Structure Depiction of
ethyl 1-({2-[(2-fluorophenyl)methyl]-1H-benzimidazol-1-yl}acetyl)piperidine-4-carboxylate
ethyl 1-({2-[(2-fluorophenyl)methyl]-1H-benzimidazol-1-yl}acetyl)piperidine-4-carboxylate
Compound characteristics
| Compound ID: | V015-4875 |
| Compound Name: | ethyl 1-({2-[(2-fluorophenyl)methyl]-1H-benzimidazol-1-yl}acetyl)piperidine-4-carboxylate |
| Molecular Weight: | 423.49 |
| Molecular Formula: | C24 H26 F N3 O3 |
| Smiles: | CCOC(C1CCN(CC1)C(Cn1c2ccccc2nc1Cc1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8949 |
| logD: | 3.8592 |
| logSw: | -3.7399 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.018 |
| InChI Key: | DJCYUGRHOVCQKK-UHFFFAOYSA-N |