N-cyclopropyl-N-{[5-(diethylamino)-3-phenyl-1,2-oxazol-4-yl]methyl}-3,3-dimethylbutanamide
Chemical Structure Depiction of
N-cyclopropyl-N-{[5-(diethylamino)-3-phenyl-1,2-oxazol-4-yl]methyl}-3,3-dimethylbutanamide
N-cyclopropyl-N-{[5-(diethylamino)-3-phenyl-1,2-oxazol-4-yl]methyl}-3,3-dimethylbutanamide
Compound characteristics
| Compound ID: | V015-4907 |
| Compound Name: | N-cyclopropyl-N-{[5-(diethylamino)-3-phenyl-1,2-oxazol-4-yl]methyl}-3,3-dimethylbutanamide |
| Molecular Weight: | 383.53 |
| Molecular Formula: | C23 H33 N3 O2 |
| Salt: | not_available |
| Smiles: | CCN(CC)c1c(CN(C2CC2)C(CC(C)(C)C)=O)c(c2ccccc2)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.0756 |
| logD: | 5.0756 |
| logSw: | -4.8355 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 41.08 |
| InChI Key: | MQSVZGCZZYRVFD-UHFFFAOYSA-N |