4-[4-(4-fluorobenzamido)phenyl]-3-(3-methoxyphenyl)-1-(3-methylphenyl)-1H-pyrazol-5-yl acetate
Chemical Structure Depiction of
4-[4-(4-fluorobenzamido)phenyl]-3-(3-methoxyphenyl)-1-(3-methylphenyl)-1H-pyrazol-5-yl acetate
4-[4-(4-fluorobenzamido)phenyl]-3-(3-methoxyphenyl)-1-(3-methylphenyl)-1H-pyrazol-5-yl acetate
Compound characteristics
| Compound ID: | V015-6372 |
| Compound Name: | 4-[4-(4-fluorobenzamido)phenyl]-3-(3-methoxyphenyl)-1-(3-methylphenyl)-1H-pyrazol-5-yl acetate |
| Molecular Weight: | 535.58 |
| Molecular Formula: | C32 H26 F N3 O4 |
| Smiles: | CC(=O)Oc1c(c2ccc(cc2)NC(c2ccc(cc2)F)=O)c(c2cccc(c2)OC)nn1c1cccc(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 6.7619 |
| logD: | 6.7616 |
| logSw: | -5.7974 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.209 |
| InChI Key: | WRFTYGDYPVHGHG-UHFFFAOYSA-N |