N,N-diethyl-2-[4-(3-methoxybenzamido)piperidin-1-yl]benzamide
Chemical Structure Depiction of
N,N-diethyl-2-[4-(3-methoxybenzamido)piperidin-1-yl]benzamide
N,N-diethyl-2-[4-(3-methoxybenzamido)piperidin-1-yl]benzamide
Compound characteristics
| Compound ID: | V015-7270 |
| Compound Name: | N,N-diethyl-2-[4-(3-methoxybenzamido)piperidin-1-yl]benzamide |
| Molecular Weight: | 409.53 |
| Molecular Formula: | C24 H31 N3 O3 |
| Salt: | not_available |
| Smiles: | CCN(CC)C(c1ccccc1N1CCC(CC1)NC(c1cccc(c1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0052 |
| logD: | 3.0052 |
| logSw: | -3.6183 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.812 |
| InChI Key: | PYCXPQSCURMSMG-UHFFFAOYSA-N |