N-[2-(4-chlorobutanamido)ethyl]-2-[(2-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
N-[2-(4-chlorobutanamido)ethyl]-2-[(2-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxamide
N-[2-(4-chlorobutanamido)ethyl]-2-[(2-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V016-4310 |
| Compound Name: | N-[2-(4-chlorobutanamido)ethyl]-2-[(2-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 411.91 |
| Molecular Formula: | C18 H22 Cl N3 O4 S |
| Smiles: | COc1ccccc1OCc1nc(cs1)C(NCCNC(CCC[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4648 |
| logD: | 1.4648 |
| logSw: | -2.2298 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.523 |
| InChI Key: | HVHCELZUCZOCGK-UHFFFAOYSA-N |