1-{(2-methylpropyl)[(thiophen-3-yl)methyl]amino}-3-[(prop-2-yn-1-yl)oxy]propan-2-ol
Chemical Structure Depiction of
1-{(2-methylpropyl)[(thiophen-3-yl)methyl]amino}-3-[(prop-2-yn-1-yl)oxy]propan-2-ol
1-{(2-methylpropyl)[(thiophen-3-yl)methyl]amino}-3-[(prop-2-yn-1-yl)oxy]propan-2-ol
Compound characteristics
| Compound ID: | V016-7673 |
| Compound Name: | 1-{(2-methylpropyl)[(thiophen-3-yl)methyl]amino}-3-[(prop-2-yn-1-yl)oxy]propan-2-ol |
| Molecular Weight: | 281.42 |
| Molecular Formula: | C15 H23 N O2 S |
| Salt: | not_available |
| Smiles: | CC(C)CN(CC(COCC#C)O)Cc1ccsc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5113 |
| logD: | 1.5655 |
| logSw: | -2.3493 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.2124 |
| InChI Key: | MIZXMZKLCZHHOM-HNNXBMFYSA-N |