1-{[(4-fluorophenyl)methyl][(4-methylphenyl)methyl]amino}-3-(2-methylphenoxy)propan-2-ol
Chemical Structure Depiction of
1-{[(4-fluorophenyl)methyl][(4-methylphenyl)methyl]amino}-3-(2-methylphenoxy)propan-2-ol
1-{[(4-fluorophenyl)methyl][(4-methylphenyl)methyl]amino}-3-(2-methylphenoxy)propan-2-ol
Compound characteristics
| Compound ID: | V016-7675 |
| Compound Name: | 1-{[(4-fluorophenyl)methyl][(4-methylphenyl)methyl]amino}-3-(2-methylphenoxy)propan-2-ol |
| Molecular Weight: | 393.5 |
| Molecular Formula: | C25 H28 F N O2 |
| Salt: | not_available |
| Smiles: | Cc1ccc(CN(CC(COc2ccccc2C)O)Cc2ccc(cc2)F)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6874 |
| logD: | 5.6016 |
| logSw: | -5.6105 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 27.8838 |
| InChI Key: | FUTQDDDGLOBMPL-DEOSSOPVSA-N |