[5-(4-tert-butylphenyl)-1,2-oxazol-3-yl](2-methylpiperidin-1-yl)methanone
Chemical Structure Depiction of
[5-(4-tert-butylphenyl)-1,2-oxazol-3-yl](2-methylpiperidin-1-yl)methanone
[5-(4-tert-butylphenyl)-1,2-oxazol-3-yl](2-methylpiperidin-1-yl)methanone
Compound characteristics
| Compound ID: | V016-8092 |
| Compound Name: | [5-(4-tert-butylphenyl)-1,2-oxazol-3-yl](2-methylpiperidin-1-yl)methanone |
| Molecular Weight: | 326.44 |
| Molecular Formula: | C20 H26 N2 O2 |
| Smiles: | CC1CCCCN1C(c1cc(c2ccc(cc2)C(C)(C)C)on1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1458 |
| logD: | 5.1458 |
| logSw: | -5.0033 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.707 |
| InChI Key: | KQFDHZJFMAWCQM-AWEZNQCLSA-N |