N-[(3-fluorophenyl)methyl]-N-[4-(2-{[3-(morpholin-4-yl)propyl]amino}-2-oxoethyl)phenyl]-3-phenylprop-2-enamide
Chemical Structure Depiction of
N-[(3-fluorophenyl)methyl]-N-[4-(2-{[3-(morpholin-4-yl)propyl]amino}-2-oxoethyl)phenyl]-3-phenylprop-2-enamide
N-[(3-fluorophenyl)methyl]-N-[4-(2-{[3-(morpholin-4-yl)propyl]amino}-2-oxoethyl)phenyl]-3-phenylprop-2-enamide
Compound characteristics
| Compound ID: | V016-8356 |
| Compound Name: | N-[(3-fluorophenyl)methyl]-N-[4-(2-{[3-(morpholin-4-yl)propyl]amino}-2-oxoethyl)phenyl]-3-phenylprop-2-enamide |
| Molecular Weight: | 515.63 |
| Molecular Formula: | C31 H34 F N3 O3 |
| Salt: | not_available |
| Smiles: | C(CNC(Cc1ccc(cc1)N(Cc1cccc(c1)F)C(/C=C/c1ccccc1)=O)=O)CN1CCOCC1 |
| Stereo: | ACHIRAL |
| logP: | 3.8138 |
| logD: | 3.3903 |
| logSw: | -4.1053 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.995 |
| InChI Key: | YTRMZXNOKDKTRR-UHFFFAOYSA-N |