N-[2-(dimethylamino)ethyl]-5-methyl-1-phenyl-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
N-[2-(dimethylamino)ethyl]-5-methyl-1-phenyl-1H-pyrazole-4-carboxamide
N-[2-(dimethylamino)ethyl]-5-methyl-1-phenyl-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | V016-8520 |
| Compound Name: | N-[2-(dimethylamino)ethyl]-5-methyl-1-phenyl-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 272.35 |
| Molecular Formula: | C15 H20 N4 O |
| Smiles: | Cc1c(cnn1c1ccccc1)C(NCCN(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6596 |
| logD: | 0.8204 |
| logSw: | -2.3486 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.695 |
| InChI Key: | KEFJFKVHPITRJE-UHFFFAOYSA-N |