N-[4-(cyclopropylmethyl)-2-ethyl-3-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl]-2-(3-methoxyphenyl)acetamide
Chemical Structure Depiction of
N-[4-(cyclopropylmethyl)-2-ethyl-3-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl]-2-(3-methoxyphenyl)acetamide
N-[4-(cyclopropylmethyl)-2-ethyl-3-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl]-2-(3-methoxyphenyl)acetamide
Compound characteristics
| Compound ID: | V016-8636 |
| Compound Name: | N-[4-(cyclopropylmethyl)-2-ethyl-3-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl]-2-(3-methoxyphenyl)acetamide |
| Molecular Weight: | 408.5 |
| Molecular Formula: | C24 H28 N2 O4 |
| Smiles: | CCC1C(N(CC2CC2)Cc2cc(ccc2O1)NC(Cc1cccc(c1)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0737 |
| logD: | 4.0736 |
| logSw: | -4.2994 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.72 |
| InChI Key: | BOEPFYCNOBPARQ-NRFANRHFSA-N |