2-({4-[2-hydroxy-3-(morpholin-4-yl)propyl]piperazin-1-yl}methyl)-N-{[3-(trifluoromethyl)phenyl]methyl}-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
2-({4-[2-hydroxy-3-(morpholin-4-yl)propyl]piperazin-1-yl}methyl)-N-{[3-(trifluoromethyl)phenyl]methyl}-1,3-oxazole-4-carboxamide
2-({4-[2-hydroxy-3-(morpholin-4-yl)propyl]piperazin-1-yl}methyl)-N-{[3-(trifluoromethyl)phenyl]methyl}-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | V016-9106 |
| Compound Name: | 2-({4-[2-hydroxy-3-(morpholin-4-yl)propyl]piperazin-1-yl}methyl)-N-{[3-(trifluoromethyl)phenyl]methyl}-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 511.54 |
| Molecular Formula: | C24 H32 F3 N5 O4 |
| Smiles: | C(c1cccc(c1)C(F)(F)F)NC(c1coc(CN2CCN(CC2)CC(CN2CCOCC2)O)n1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.7642 |
| logD: | 0.706 |
| logSw: | -1.9016 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.863 |
| InChI Key: | GFEVDGLDNNIUFM-FQEVSTJZSA-N |