1-[(2-methoxyethyl){[5-(4-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl}amino]-3-[(propan-2-yl)oxy]propan-2-ol
Chemical Structure Depiction of
1-[(2-methoxyethyl){[5-(4-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl}amino]-3-[(propan-2-yl)oxy]propan-2-ol
1-[(2-methoxyethyl){[5-(4-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl}amino]-3-[(propan-2-yl)oxy]propan-2-ol
Compound characteristics
| Compound ID: | V016-9496 |
| Compound Name: | 1-[(2-methoxyethyl){[5-(4-methylpiperidin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl}amino]-3-[(propan-2-yl)oxy]propan-2-ol |
| Molecular Weight: | 445.6 |
| Molecular Formula: | C25 H39 N3 O4 |
| Salt: | not_available |
| Smiles: | CC1CCN(CC1)c1c(CN(CCOC)CC(COC(C)C)O)c(c2ccccc2)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6041 |
| logD: | 1.6754 |
| logSw: | -3.4892 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.743 |
| InChI Key: | UENJJFONWXPLPV-QFIPXVFZSA-N |