N-[(3-fluorophenyl)methyl]-N-[4-(2-{[(4-fluorophenyl)methyl]amino}-2-oxoethyl)phenyl]-2-methoxyacetamide
Chemical Structure Depiction of
N-[(3-fluorophenyl)methyl]-N-[4-(2-{[(4-fluorophenyl)methyl]amino}-2-oxoethyl)phenyl]-2-methoxyacetamide
N-[(3-fluorophenyl)methyl]-N-[4-(2-{[(4-fluorophenyl)methyl]amino}-2-oxoethyl)phenyl]-2-methoxyacetamide
Compound characteristics
| Compound ID: | V016-9566 |
| Compound Name: | N-[(3-fluorophenyl)methyl]-N-[4-(2-{[(4-fluorophenyl)methyl]amino}-2-oxoethyl)phenyl]-2-methoxyacetamide |
| Molecular Weight: | 438.47 |
| Molecular Formula: | C25 H24 F2 N2 O3 |
| Smiles: | COCC(N(Cc1cccc(c1)F)c1ccc(CC(NCc2ccc(cc2)F)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4846 |
| logD: | 3.4846 |
| logSw: | -3.7259 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.957 |
| InChI Key: | RWLWAFHITSMSAP-UHFFFAOYSA-N |