N-[3-(2-{[2-(dimethylamino)ethyl]amino}-2-oxoethyl)phenyl]-N-[(4-methylphenyl)methyl]-2-phenoxyacetamide
Chemical Structure Depiction of
N-[3-(2-{[2-(dimethylamino)ethyl]amino}-2-oxoethyl)phenyl]-N-[(4-methylphenyl)methyl]-2-phenoxyacetamide
N-[3-(2-{[2-(dimethylamino)ethyl]amino}-2-oxoethyl)phenyl]-N-[(4-methylphenyl)methyl]-2-phenoxyacetamide
Compound characteristics
| Compound ID: | V017-0292 |
| Compound Name: | N-[3-(2-{[2-(dimethylamino)ethyl]amino}-2-oxoethyl)phenyl]-N-[(4-methylphenyl)methyl]-2-phenoxyacetamide |
| Molecular Weight: | 459.59 |
| Molecular Formula: | C28 H33 N3 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccc(CN(C(COc2ccccc2)=O)c2cccc(CC(NCCN(C)C)=O)c2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.572 |
| logD: | 1.9581 |
| logSw: | -3.6577 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.74 |
| InChI Key: | JRSTXTMOTJCYCC-UHFFFAOYSA-N |