methyl 7-methyl-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-5-[4-(propan-2-yl)phenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Chemical Structure Depiction of
methyl 7-methyl-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-5-[4-(propan-2-yl)phenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
methyl 7-methyl-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-5-[4-(propan-2-yl)phenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | V017-0556 |
| Compound Name: | methyl 7-methyl-3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-5-[4-(propan-2-yl)phenyl]-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| Molecular Weight: | 467.63 |
| Molecular Formula: | C26 H33 N3 O3 S |
| Smiles: | CC1CCN(CC1)C(CC1=CSC2=NC(C)=C(C(c3ccc(cc3)C(C)C)N12)C(=O)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.928 |
| logD: | 4.9274 |
| logSw: | -4.6711 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 48.951 |
| InChI Key: | DAELQZLUYQOBSE-XMMPIXPASA-N |