4-chloro-N-{3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Chemical Structure Depiction of
4-chloro-N-{3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
4-chloro-N-{3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide
Compound characteristics
| Compound ID: | V017-1323 |
| Compound Name: | 4-chloro-N-{3-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxo-1,3-thiazolidin-2-yl]phenyl}benzamide |
| Molecular Weight: | 466.94 |
| Molecular Formula: | C24 H19 Cl N2 O4 S |
| Smiles: | C1COc2cc(ccc2O1)N1C(c2cccc(c2)NC(c2ccc(cc2)[Cl])=O)SCC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8846 |
| logD: | 3.8833 |
| logSw: | -4.6155 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.047 |
| InChI Key: | JFXTWZKYBTYCHL-DEOSSOPVSA-N |