N-(3-methoxyphenyl)-N-{1-[(4-methylphenyl)methyl]piperidin-4-yl}furan-2-carboxamide
Chemical Structure Depiction of
N-(3-methoxyphenyl)-N-{1-[(4-methylphenyl)methyl]piperidin-4-yl}furan-2-carboxamide
N-(3-methoxyphenyl)-N-{1-[(4-methylphenyl)methyl]piperidin-4-yl}furan-2-carboxamide
Compound characteristics
| Compound ID: | V017-1484 |
| Compound Name: | N-(3-methoxyphenyl)-N-{1-[(4-methylphenyl)methyl]piperidin-4-yl}furan-2-carboxamide |
| Molecular Weight: | 404.51 |
| Molecular Formula: | C25 H28 N2 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccc(CN2CCC(CC2)N(C(c2ccco2)=O)c2cccc(c2)OC)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6928 |
| logD: | 3.5708 |
| logSw: | -4.4049 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 34.605 |
| InChI Key: | GTQVTGGQFQKRTQ-UHFFFAOYSA-N |