[4-(4-fluoro-3-methylphenoxy)-2-(4-methylpiperazin-1-yl)-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl](4-fluorophenyl)methanone
Chemical Structure Depiction of
[4-(4-fluoro-3-methylphenoxy)-2-(4-methylpiperazin-1-yl)-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl](4-fluorophenyl)methanone
[4-(4-fluoro-3-methylphenoxy)-2-(4-methylpiperazin-1-yl)-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl](4-fluorophenyl)methanone
Compound characteristics
| Compound ID: | V017-2312 |
| Compound Name: | [4-(4-fluoro-3-methylphenoxy)-2-(4-methylpiperazin-1-yl)-7,8-dihydropyrido[4,3-d]pyrimidin-6(5H)-yl](4-fluorophenyl)methanone |
| Molecular Weight: | 479.53 |
| Molecular Formula: | C26 H27 F2 N5 O2 |
| Salt: | not_available |
| Smiles: | Cc1cc(ccc1F)Oc1c2CN(CCc2nc(n1)N1CCN(C)CC1)C(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2028 |
| logD: | 3.6309 |
| logSw: | -4.3384 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.982 |
| InChI Key: | PNIKAHFVOBLNFU-UHFFFAOYSA-N |