3-(4-chlorophenyl)-1-(2-methoxyethyl)-7-[(4-methylphenyl)methyl]-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
3-(4-chlorophenyl)-1-(2-methoxyethyl)-7-[(4-methylphenyl)methyl]-3,7-dihydro-1H-purine-2,6-dione
3-(4-chlorophenyl)-1-(2-methoxyethyl)-7-[(4-methylphenyl)methyl]-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | V017-2748 |
| Compound Name: | 3-(4-chlorophenyl)-1-(2-methoxyethyl)-7-[(4-methylphenyl)methyl]-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 424.89 |
| Molecular Formula: | C22 H21 Cl N4 O3 |
| Salt: | not_available |
| Smiles: | Cc1ccc(Cn2cnc3c2C(N(CCOC)C(N3c2ccc(cc2)[Cl])=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.2448 |
| logD: | 3.2448 |
| logSw: | -3.3712 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.867 |
| InChI Key: | RSPJOQKSNXMOMX-UHFFFAOYSA-N |