N-(4-fluorophenyl)-2-[4-(2-methylphenyl)piperazin-1-yl]propanamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-2-[4-(2-methylphenyl)piperazin-1-yl]propanamide
N-(4-fluorophenyl)-2-[4-(2-methylphenyl)piperazin-1-yl]propanamide
Compound characteristics
| Compound ID: | V017-3141 |
| Compound Name: | N-(4-fluorophenyl)-2-[4-(2-methylphenyl)piperazin-1-yl]propanamide |
| Molecular Weight: | 341.43 |
| Molecular Formula: | C20 H24 F N3 O |
| Salt: | not_available |
| Smiles: | CC(C(Nc1ccc(cc1)F)=O)N1CCN(CC1)c1ccccc1C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6304 |
| logD: | 3.6283 |
| logSw: | -3.8188 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.9654 |
| InChI Key: | IJTIICVJTQFVNE-INIZCTEOSA-N |