N-(2-methylpropyl)-2-(4-{[2-(trifluoromethyl)phenyl]methoxy}phenyl)-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
N-(2-methylpropyl)-2-(4-{[2-(trifluoromethyl)phenyl]methoxy}phenyl)-1,3-thiazole-4-carboxamide
N-(2-methylpropyl)-2-(4-{[2-(trifluoromethyl)phenyl]methoxy}phenyl)-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V017-3405 |
| Compound Name: | N-(2-methylpropyl)-2-(4-{[2-(trifluoromethyl)phenyl]methoxy}phenyl)-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 434.48 |
| Molecular Formula: | C22 H21 F3 N2 O2 S |
| Smiles: | CC(C)CNC(c1csc(c2ccc(cc2)OCc2ccccc2C(F)(F)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7561 |
| logD: | 5.7561 |
| logSw: | -5.4884 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.885 |
| InChI Key: | KYXKBSPMQHOLTQ-UHFFFAOYSA-N |