N'-benzyl-N-[(oxolan-2-yl)methyl]-N-{[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl}urea
Chemical Structure Depiction of
N'-benzyl-N-[(oxolan-2-yl)methyl]-N-{[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl}urea
N'-benzyl-N-[(oxolan-2-yl)methyl]-N-{[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl}urea
Compound characteristics
| Compound ID: | V017-3793 |
| Compound Name: | N'-benzyl-N-[(oxolan-2-yl)methyl]-N-{[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-3-yl]methyl}urea |
| Molecular Weight: | 481.55 |
| Molecular Formula: | C26 H31 N3 O6 |
| Smiles: | COc1cc(cc(c1OC)OC)c1cc(CN(CC2CCCO2)C(NCc2ccccc2)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1145 |
| logD: | 3.1145 |
| logSw: | -3.3732 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.984 |
| InChI Key: | WINIKKINEMVRIM-OAQYLSRUSA-N |