4-chloro-N-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]benzene-1-sulfonamide
4-chloro-N-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | V017-4296 |
| Compound Name: | 4-chloro-N-(4-fluorophenyl)-N-[(2-methoxyphenyl)methyl]benzene-1-sulfonamide |
| Molecular Weight: | 405.87 |
| Molecular Formula: | C20 H17 Cl F N O3 S |
| Smiles: | COc1ccccc1CN(c1ccc(cc1)F)S(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2048 |
| logD: | 5.2048 |
| logSw: | -5.7746 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.423 |
| InChI Key: | BLISGCHJSUDYTQ-UHFFFAOYSA-N |