N-[6-(3,4-difluorophenoxy)pyridin-3-yl]-4-fluorobenzamide
Chemical Structure Depiction of
N-[6-(3,4-difluorophenoxy)pyridin-3-yl]-4-fluorobenzamide
N-[6-(3,4-difluorophenoxy)pyridin-3-yl]-4-fluorobenzamide
Compound characteristics
| Compound ID: | V017-5180 |
| Compound Name: | N-[6-(3,4-difluorophenoxy)pyridin-3-yl]-4-fluorobenzamide |
| Molecular Weight: | 344.29 |
| Molecular Formula: | C18 H11 F3 N2 O2 |
| Salt: | not_available |
| Smiles: | c1cc(ccc1C(Nc1ccc(nc1)Oc1ccc(c(c1)F)F)=O)F |
| Stereo: | ACHIRAL |
| logP: | 4.0112 |
| logD: | 4.0091 |
| logSw: | -4.2165 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.115 |
| InChI Key: | YYMZFJZKMSAFAA-UHFFFAOYSA-N |