N-(4-{[1-(3-methylphenyl)ethyl](phenyl)sulfamoyl}phenyl)acetamide
Chemical Structure Depiction of
N-(4-{[1-(3-methylphenyl)ethyl](phenyl)sulfamoyl}phenyl)acetamide
N-(4-{[1-(3-methylphenyl)ethyl](phenyl)sulfamoyl}phenyl)acetamide
Compound characteristics
| Compound ID: | V017-7274 |
| Compound Name: | N-(4-{[1-(3-methylphenyl)ethyl](phenyl)sulfamoyl}phenyl)acetamide |
| Molecular Weight: | 408.52 |
| Molecular Formula: | C23 H24 N2 O3 S |
| Smiles: | CC(c1cccc(C)c1)N(c1ccccc1)S(c1ccc(cc1)NC(C)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6852 |
| logD: | 4.6851 |
| logSw: | -4.4105 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.565 |
| InChI Key: | MIHGHKBHBCQORJ-SFHVURJKSA-N |