4-(4-bromobenzoyl)-1-(2-chlorophenyl)-3-methylpiperazin-2-one
Chemical Structure Depiction of
4-(4-bromobenzoyl)-1-(2-chlorophenyl)-3-methylpiperazin-2-one
4-(4-bromobenzoyl)-1-(2-chlorophenyl)-3-methylpiperazin-2-one
Compound characteristics
| Compound ID: | V017-8635 |
| Compound Name: | 4-(4-bromobenzoyl)-1-(2-chlorophenyl)-3-methylpiperazin-2-one |
| Molecular Weight: | 407.69 |
| Molecular Formula: | C18 H16 Br Cl N2 O2 |
| Smiles: | CC1C(N(CCN1C(c1ccc(cc1)[Br])=O)c1ccccc1[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8719 |
| logD: | 3.8719 |
| logSw: | -4.2026 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.675 |
| InChI Key: | FNNJXDWCZMDHJE-LBPRGKRZSA-N |