5-[(3-{4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl}phenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
5-[(3-{4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl}phenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
5-[(3-{4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl}phenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | V017-9197 |
| Compound Name: | 5-[(3-{4-[2-(dimethylamino)ethyl]piperazine-1-carbonyl}phenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 496.6 |
| Molecular Formula: | C26 H29 F N4 O3 S |
| Salt: | not_available |
| Smiles: | CN(C)CCN1CCN(CC1)C(c1cccc(/C=C2/C(N(Cc3ccc(cc3)F)C(=O)S2)=O)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9291 |
| logD: | 2.0271 |
| logSw: | -3.1776 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 53.9 |
| InChI Key: | VDORSTCSTCICLB-UHFFFAOYSA-N |