3-[(4-fluorophenyl)methyl]-5-({3-[4-(2-methoxyethyl)piperazine-1-carbonyl]phenyl}methylidene)-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
3-[(4-fluorophenyl)methyl]-5-({3-[4-(2-methoxyethyl)piperazine-1-carbonyl]phenyl}methylidene)-1,3-thiazolidine-2,4-dione
3-[(4-fluorophenyl)methyl]-5-({3-[4-(2-methoxyethyl)piperazine-1-carbonyl]phenyl}methylidene)-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | V017-9209 |
| Compound Name: | 3-[(4-fluorophenyl)methyl]-5-({3-[4-(2-methoxyethyl)piperazine-1-carbonyl]phenyl}methylidene)-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 483.56 |
| Molecular Formula: | C25 H26 F N3 O4 S |
| Salt: | not_available |
| Smiles: | COCCN1CCN(CC1)C(c1cccc(/C=C2/C(N(Cc3ccc(cc3)F)C(=O)S2)=O)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9731 |
| logD: | 2.9509 |
| logSw: | -3.2012 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 58.377 |
| InChI Key: | LDHBXKYGMJRVML-UHFFFAOYSA-N |