2-{[(3,4-dimethylphenyl)methyl]sulfanyl}-3-(2-methoxyphenyl)quinazolin-4(3H)-one
Chemical Structure Depiction of
2-{[(3,4-dimethylphenyl)methyl]sulfanyl}-3-(2-methoxyphenyl)quinazolin-4(3H)-one
2-{[(3,4-dimethylphenyl)methyl]sulfanyl}-3-(2-methoxyphenyl)quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | V017-9271 |
| Compound Name: | 2-{[(3,4-dimethylphenyl)methyl]sulfanyl}-3-(2-methoxyphenyl)quinazolin-4(3H)-one |
| Molecular Weight: | 402.51 |
| Molecular Formula: | C24 H22 N2 O2 S |
| Smiles: | Cc1ccc(CSC2=Nc3ccccc3C(N2c2ccccc2OC)=O)cc1C |
| Stereo: | ACHIRAL |
| logP: | 5.0135 |
| logD: | 5.013 |
| logSw: | -4.6784 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.489 |
| InChI Key: | FYQBMZQBNMJHTE-UHFFFAOYSA-N |