5-ethyl-N,3-bis(2-methylpropyl)-1-phenyl-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
5-ethyl-N,3-bis(2-methylpropyl)-1-phenyl-1H-pyrazole-4-carboxamide
5-ethyl-N,3-bis(2-methylpropyl)-1-phenyl-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | V018-0214 |
| Compound Name: | 5-ethyl-N,3-bis(2-methylpropyl)-1-phenyl-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 327.47 |
| Molecular Formula: | C20 H29 N3 O |
| Smiles: | CCc1c(C(NCC(C)C)=O)c(CC(C)C)nn1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.3475 |
| logD: | 4.3475 |
| logSw: | -4.2968 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.54 |
| InChI Key: | MZBQTEIUEUJJDA-UHFFFAOYSA-N |