N-{[1-benzyl-2-(phenylmethanesulfonyl)-1H-imidazol-5-yl]methyl}-N-[(furan-2-yl)methyl]acetamide
Chemical Structure Depiction of
N-{[1-benzyl-2-(phenylmethanesulfonyl)-1H-imidazol-5-yl]methyl}-N-[(furan-2-yl)methyl]acetamide
N-{[1-benzyl-2-(phenylmethanesulfonyl)-1H-imidazol-5-yl]methyl}-N-[(furan-2-yl)methyl]acetamide
Compound characteristics
| Compound ID: | V018-0233 |
| Compound Name: | N-{[1-benzyl-2-(phenylmethanesulfonyl)-1H-imidazol-5-yl]methyl}-N-[(furan-2-yl)methyl]acetamide |
| Molecular Weight: | 463.55 |
| Molecular Formula: | C25 H25 N3 O4 S |
| Salt: | not_available |
| Smiles: | CC(N(Cc1cnc(n1Cc1ccccc1)S(Cc1ccccc1)(=O)=O)Cc1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3334 |
| logD: | 3.3334 |
| logSw: | -3.3863 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 65.079 |
| InChI Key: | RPRYPZKSPSTXFG-UHFFFAOYSA-N |