3-(3-{4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl}-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl)-N-[2-(piperidin-1-yl)ethyl]propanamide
Chemical Structure Depiction of
3-(3-{4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl}-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl)-N-[2-(piperidin-1-yl)ethyl]propanamide
3-(3-{4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl}-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl)-N-[2-(piperidin-1-yl)ethyl]propanamide
Compound characteristics
| Compound ID: | V018-0328 |
| Compound Name: | 3-(3-{4-[(3-fluorophenyl)methoxy]-3-methoxyphenyl}-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl)-N-[2-(piperidin-1-yl)ethyl]propanamide |
| Molecular Weight: | 509.58 |
| Molecular Formula: | C27 H32 F N5 O4 |
| Salt: | not_available |
| Smiles: | COc1cc(ccc1OCc1cccc(c1)F)C1NN=C(CCC(NCCN2CCCCC2)=O)C(N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1969 |
| logD: | 2.1969 |
| logSw: | -2.7532 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 89.548 |
| InChI Key: | KLRQQJOZNYDTBZ-UHFFFAOYSA-N |