2-{2-[(3,5-difluorophenyl)methoxy]phenyl}-N-[(furan-2-yl)methyl]-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
2-{2-[(3,5-difluorophenyl)methoxy]phenyl}-N-[(furan-2-yl)methyl]-1,3-thiazole-4-carboxamide
2-{2-[(3,5-difluorophenyl)methoxy]phenyl}-N-[(furan-2-yl)methyl]-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V018-2073 |
| Compound Name: | 2-{2-[(3,5-difluorophenyl)methoxy]phenyl}-N-[(furan-2-yl)methyl]-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 426.44 |
| Molecular Formula: | C22 H16 F2 N2 O3 S |
| Smiles: | C(c1ccco1)NC(c1csc(c2ccccc2OCc2cc(cc(c2)F)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6731 |
| logD: | 5.6731 |
| logSw: | -5.8707 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.449 |
| InChI Key: | NPQIEZRGTVDGMA-UHFFFAOYSA-N |