N-(butan-2-yl)-3-fluoro-N-{[3-(4-fluorophenyl)-5-(morpholin-4-yl)-1,2-oxazol-4-yl]methyl}benzamide
Chemical Structure Depiction of
N-(butan-2-yl)-3-fluoro-N-{[3-(4-fluorophenyl)-5-(morpholin-4-yl)-1,2-oxazol-4-yl]methyl}benzamide
N-(butan-2-yl)-3-fluoro-N-{[3-(4-fluorophenyl)-5-(morpholin-4-yl)-1,2-oxazol-4-yl]methyl}benzamide
Compound characteristics
| Compound ID: | V018-2264 |
| Compound Name: | N-(butan-2-yl)-3-fluoro-N-{[3-(4-fluorophenyl)-5-(morpholin-4-yl)-1,2-oxazol-4-yl]methyl}benzamide |
| Molecular Weight: | 455.5 |
| Molecular Formula: | C25 H27 F2 N3 O3 |
| Smiles: | CCC(C)N(Cc1c(c2ccc(cc2)F)noc1N1CCOCC1)C(c1cccc(c1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6012 |
| logD: | 4.6012 |
| logSw: | -4.4148 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.984 |
| InChI Key: | XQLQVTXNDDMZOB-KRWDZBQOSA-N |