1-(3,4-dimethylphenyl)-3-methyl-4-[(2-methylphenyl)methyl]piperazin-2-one
Chemical Structure Depiction of
1-(3,4-dimethylphenyl)-3-methyl-4-[(2-methylphenyl)methyl]piperazin-2-one
1-(3,4-dimethylphenyl)-3-methyl-4-[(2-methylphenyl)methyl]piperazin-2-one
Compound characteristics
| Compound ID: | V018-2773 |
| Compound Name: | 1-(3,4-dimethylphenyl)-3-methyl-4-[(2-methylphenyl)methyl]piperazin-2-one |
| Molecular Weight: | 322.45 |
| Molecular Formula: | C21 H26 N2 O |
| Salt: | not_available |
| Smiles: | CC1C(N(CCN1Cc1ccccc1C)c1ccc(C)c(C)c1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8666 |
| logD: | 4.8664 |
| logSw: | -4.5685 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 19.2259 |
| InChI Key: | YHNYCBAYMOPUJT-SFHVURJKSA-N |