3'-(2-fluorobenzoyl)-5-methyl-1-[(3-methylphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
Chemical Structure Depiction of
3'-(2-fluorobenzoyl)-5-methyl-1-[(3-methylphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
3'-(2-fluorobenzoyl)-5-methyl-1-[(3-methylphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
Compound characteristics
| Compound ID: | V018-2842 |
| Compound Name: | 3'-(2-fluorobenzoyl)-5-methyl-1-[(3-methylphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one |
| Molecular Weight: | 446.54 |
| Molecular Formula: | C26 H23 F N2 O2 S |
| Smiles: | Cc1cccc(CN2C(C3(c4cc(C)ccc24)N(CCS3)C(c2ccccc2F)=O)=O)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.7151 |
| logD: | 5.7151 |
| logSw: | -5.4329 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.5794 |
| InChI Key: | MCJFLGOCZMIYCD-SANMLTNESA-N |