N-[5-(2H-1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-Nalpha-[(2-bromophenyl)carbamoyl]phenylalaninamide
					Chemical Structure Depiction of
N-[5-(2H-1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-Nalpha-[(2-bromophenyl)carbamoyl]phenylalaninamide
			N-[5-(2H-1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-Nalpha-[(2-bromophenyl)carbamoyl]phenylalaninamide
Compound characteristics
| Compound ID: | V018-3158 | 
| Compound Name: | N-[5-(2H-1,3-benzodioxol-5-yl)-1,3,4-thiadiazol-2-yl]-Nalpha-[(2-bromophenyl)carbamoyl]phenylalaninamide | 
| Molecular Weight: | 566.43 | 
| Molecular Formula: | C25 H20 Br N5 O4 S | 
| Salt: | not_available | 
| Smiles: | C(C(C(Nc1nnc(c2ccc3c(c2)OCO3)s1)=O)NC(Nc1ccccc1[Br])=O)c1ccccc1 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 5.1454 | 
| logD: | 5.145 | 
| logSw: | -5.5294 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 3 | 
| Polar surface area: | 96.276 | 
| InChI Key: | TVFRBYUGWQOZPF-IBGZPJMESA-N | 
 
				 
				