2-({cyclopropyl[(3,4-dichlorophenyl)methyl]amino}methyl)-N-[(pyridin-3-yl)methyl]-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
2-({cyclopropyl[(3,4-dichlorophenyl)methyl]amino}methyl)-N-[(pyridin-3-yl)methyl]-1,3-oxazole-4-carboxamide
2-({cyclopropyl[(3,4-dichlorophenyl)methyl]amino}methyl)-N-[(pyridin-3-yl)methyl]-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | V018-3463 |
| Compound Name: | 2-({cyclopropyl[(3,4-dichlorophenyl)methyl]amino}methyl)-N-[(pyridin-3-yl)methyl]-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 431.32 |
| Molecular Formula: | C21 H20 Cl2 N4 O2 |
| Salt: | not_available |
| Smiles: | C1CC1N(Cc1ccc(c(c1)[Cl])[Cl])Cc1nc(co1)C(NCc1cccnc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5902 |
| logD: | 3.5901 |
| logSw: | -3.7071 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.483 |
| InChI Key: | SQDPBSTXAWZFEQ-UHFFFAOYSA-N |