3'-(4-fluorobenzoyl)-1-[(3-methoxyphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
					Chemical Structure Depiction of
3'-(4-fluorobenzoyl)-1-[(3-methoxyphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
			3'-(4-fluorobenzoyl)-1-[(3-methoxyphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
Compound characteristics
| Compound ID: | V018-3996 | 
| Compound Name: | 3'-(4-fluorobenzoyl)-1-[(3-methoxyphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one | 
| Molecular Weight: | 448.52 | 
| Molecular Formula: | C25 H21 F N2 O3 S | 
| Smiles: | COc1cccc(CN2C(C3(c4ccccc24)N(CCS3)C(c2ccc(cc2)F)=O)=O)c1 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 4.4953 | 
| logD: | 4.4953 | 
| logSw: | -4.3419 | 
| Hydrogen bond acceptors count: | 6 | 
| Polar surface area: | 39.123 | 
| InChI Key: | CAIZADJNUGFMHG-VWLOTQADSA-N | 
 
				 
				