3'-(4-fluorobenzoyl)-1-[(3-methoxyphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
Chemical Structure Depiction of
3'-(4-fluorobenzoyl)-1-[(3-methoxyphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
3'-(4-fluorobenzoyl)-1-[(3-methoxyphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one
Compound characteristics
| Compound ID: | V018-3996 |
| Compound Name: | 3'-(4-fluorobenzoyl)-1-[(3-methoxyphenyl)methyl]spiro[indole-3,2'-[1,3]thiazolidin]-2(1H)-one |
| Molecular Weight: | 448.52 |
| Molecular Formula: | C25 H21 F N2 O3 S |
| Smiles: | COc1cccc(CN2C(C3(c4ccccc24)N(CCS3)C(c2ccc(cc2)F)=O)=O)c1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4953 |
| logD: | 4.4953 |
| logSw: | -4.3419 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 39.123 |
| InChI Key: | CAIZADJNUGFMHG-VWLOTQADSA-N |