2-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-5-[(3-fluorophenyl)methyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one
Chemical Structure Depiction of
2-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-5-[(3-fluorophenyl)methyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one
2-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-5-[(3-fluorophenyl)methyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one
Compound characteristics
| Compound ID: | V018-4149 |
| Compound Name: | 2-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-5-[(3-fluorophenyl)methyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one |
| Molecular Weight: | 414.44 |
| Molecular Formula: | C21 H23 F N4 O4 |
| Salt: | not_available |
| Smiles: | C1CN(CCC12OCCO2)C(c1cc2C(N(CCn2n1)Cc1cccc(c1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.9534 |
| logD: | 0.9534 |
| logSw: | -1.5529 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.136 |
| InChI Key: | QUMZBCHYDMIKPF-UHFFFAOYSA-N |