ethyl 6-{[4-(cyclobutanecarbonyl)piperazin-1-yl]methyl}-4-(3-fluorophenyl)-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
ethyl 6-{[4-(cyclobutanecarbonyl)piperazin-1-yl]methyl}-4-(3-fluorophenyl)-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
ethyl 6-{[4-(cyclobutanecarbonyl)piperazin-1-yl]methyl}-4-(3-fluorophenyl)-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | V018-5216 |
| Compound Name: | ethyl 6-{[4-(cyclobutanecarbonyl)piperazin-1-yl]methyl}-4-(3-fluorophenyl)-1-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 458.53 |
| Molecular Formula: | C24 H31 F N4 O4 |
| Salt: | not_available |
| Smiles: | CCOC(C1C(c2cccc(c2)F)NC(N(C)C=1CN1CCN(CC1)C(C1CCC1)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7218 |
| logD: | 0.7488 |
| logSw: | -2.2773 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.502 |
| InChI Key: | XZJXUQVAOFSZBJ-NRFANRHFSA-N |